C18H23ClO — CID 64774026
1-(4-chlorobut-1-ynyl)-3-(4-ethylcyclohexyl)oxybenzene (PubChem CID 64774026) has the molecular formula C18H23ClO and a molecular weight of 290.83 g/mol. Its IUPAC name is 1-(4-chlorobut-1-ynyl)-3-(4-ethylcyclohexyl)oxybenzene.
| Compound Name | 1-(4-chlorobut-1-ynyl)-3-(4-ethylcyclohexyl)oxybenzene |
|---|---|
| PubChem CID | 64774026 |
| Molecular Formula | C18H23ClO |
| Molecular Weight | 290.83 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-(4-chlorobut-1-ynyl)-3-(4-ethylcyclohexyl)oxybenzene |
| SMILES | CCC1CCC(Oc2cccc(C#CCCCl)c2)CC1 |
| InChI | InChI=1S/C18H23ClO/c1-2-15-9-11-17(12-10-15)20-18-8-5-7-16(14-18)6-3-4-13-19/h5,7-8,14-15,17H,2,4,9-13H2,1H3 |
| InChIKey | UPSVURZMSPMMRN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.83 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|