C12H14ClN — CID 170467787
3-(4-chlorobut-1-ynyl)-N,N-dimethylaniline (PubChem CID 170467787) has the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. Its IUPAC name is 3-(4-chlorobut-1-ynyl)-N,N-dimethylaniline.
| Compound Name | 3-(4-chlorobut-1-ynyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 170467787 |
| Molecular Formula | C12H14ClN |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-(4-chlorobut-1-ynyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C#CCCCl)c1 |
| InChI | InChI=1S/C12H14ClN/c1-14(2)12-8-5-7-11(10-12)6-3-4-9-13/h5,7-8,10H,4,9H2,1-2H3 |
| InChIKey | IZEPRJQXVVWPKV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|