C18H22ClFO — CID 81315042
1-(4-chlorobut-1-ynyl)-3-(3,4-dimethylcyclohexyl)oxy-5-fluorobenzene (PubChem CID 81315042) has the molecular formula C18H22ClFO and a molecular weight of 308.82 g/mol. Its IUPAC name is 1-(4-chlorobut-1-ynyl)-3-(3,4-dimethylcyclohexyl)oxy-5-fluorobenzene.
| Compound Name | 1-(4-chlorobut-1-ynyl)-3-(3,4-dimethylcyclohexyl)oxy-5-fluorobenzene |
|---|---|
| PubChem CID | 81315042 |
| Molecular Formula | C18H22ClFO |
| Molecular Weight | 308.82 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-(4-chlorobut-1-ynyl)-3-(3,4-dimethylcyclohexyl)oxy-5-fluorobenzene |
| SMILES | CC1CCC(Oc2cc(F)cc(C#CCCCl)c2)CC1C |
| InChI | InChI=1S/C18H22ClFO/c1-13-6-7-17(9-14(13)2)21-18-11-15(5-3-4-8-19)10-16(20)12-18/h10-14,17H,4,6-9H2,1-2H3 |
| InChIKey | MHUHVZFGONSJBP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.82 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|