C14H14ClFO3S — CID 81325753
3-[3-(4-chlorobut-1-ynyl)-5-fluorophenoxy]thiolane 1,1-dioxide (PubChem CID 81325753) has the molecular formula C14H14ClFO3S and a molecular weight of 316.78 g/mol. Its IUPAC name is 3-[3-(4-chlorobut-1-ynyl)-5-fluorophenoxy]thiolane 1,1-dioxide.
| Compound Name | 3-[3-(4-chlorobut-1-ynyl)-5-fluorophenoxy]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 81325753 |
| Molecular Formula | C14H14ClFO3S |
| Molecular Weight | 316.78 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 3-[3-(4-chlorobut-1-ynyl)-5-fluorophenoxy]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(Oc2cc(F)cc(C#CCCCl)c2)C1 |
| InChI | InChI=1S/C14H14ClFO3S/c15-5-2-1-3-11-7-12(16)9-14(8-11)19-13-4-6-20(17,18)10-13/h7-9,13H,2,4-6,10H2 |
| InChIKey | OCPNBYJKUYVZNP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.78 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|