C15H12ClF3N2 — CID 3532442
2-chloro-N-[(3-methylphenyl)methylideneamino]-5-(trifluoromethyl)aniline (PubChem CID 3532442) has the molecular formula C15H12ClF3N2 and a molecular weight of 312.72 g/mol. Its IUPAC name is 2-chloro-N-[(3-methylphenyl)methylideneamino]-5-(trifluoromethyl)aniline.
| Compound Name | 2-chloro-N-[(3-methylphenyl)methylideneamino]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 3532442 |
| Molecular Formula | C15H12ClF3N2 |
| Molecular Weight | 312.72 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-chloro-N-[(3-methylphenyl)methylideneamino]-5-(trifluoromethyl)aniline |
| SMILES | Cc1cccc(C=NNc2cc(C(F)(F)F)ccc2Cl)c1 |
| InChI | InChI=1S/C15H12ClF3N2/c1-10-3-2-4-11(7-10)9-20-21-14-8-12(15(17,18)19)5-6-13(14)16/h2-9,21H,1H3 |
| InChIKey | MNFABIGIBPFYNQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.72 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|