C25H32N2 — CID 70190206
N-[[4-[(E)-hex-3-enyl]phenyl]methylideneamino]-1-(4-pentylphenyl)methanimine (PubChem CID 70190206) has the molecular formula C25H32N2 and a molecular weight of 360.55 g/mol. Its IUPAC name is N-[[4-[(E)-hex-3-enyl]phenyl]methylideneamino]-1-(4-pentylphenyl)methanimine.
| Compound Name | N-[[4-[(E)-hex-3-enyl]phenyl]methylideneamino]-1-(4-pentylphenyl)methanimine |
|---|---|
| PubChem CID | 70190206 |
| Molecular Formula | C25H32N2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | N-[[4-[(E)-hex-3-enyl]phenyl]methylideneamino]-1-(4-pentylphenyl)methanimine |
| SMILES | CC/C=C/CCc1ccc(C=NN=Cc2ccc(CCCCC)cc2)cc1 |
| InChI | InChI=1S/C25H32N2/c1-3-5-7-9-11-23-14-18-25(19-15-23)21-27-26-20-24-16-12-22(13-17-24)10-8-6-4-2/h5,7,12-21H,3-4,6,8-11H2,1-2H3/b7-5+,26-20?,27-21? |
| InChIKey | NNBPFVGVUKXFTK-MGLDQDCTSA-N |
| XLogP | 6.77 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|