C16H16N8O3 — CID 136695485
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-5-methyltriazole-4-carboxamide (PubChem CID 136695485) has the molecular formula C16H16N8O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-5-methyltriazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 136695485 |
| Molecular Formula | C16H16N8O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(2-hydroxy-3-prop-2-enylphenyl)methylideneamino]-5-methyltriazole-4-carboxamide |
| SMILES | C=CCc1cccc(/C=N\NC(=O)c2c(C)nnn2-c2nonc2N)c1O |
| InChI | InChI=1S/C16H16N8O3/c1-3-5-10-6-4-7-11(13(10)25)8-18-20-16(26)12-9(2)19-23-24(12)15-14(17)21-27-22-15/h3-4,6-8,25H,1,5H2,2H3,(H2,17,21)(H,20,26)/b18-8- |
| InChIKey | LJURHNPZERJBPB-LSCVHKIXSA-N |
| XLogP | 0.74 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|