C16H18ClN9O2S — CID 3307317
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide (PubChem CID 3307317) has the molecular formula C16H18ClN9O2S and a molecular weight of 435.90 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3307317 |
| Molecular Formula | C16H18ClN9O2S |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(5-chlorothiophen-2-yl)ethylideneamino]-5-(pyrrolidin-1-ylmethyl)triazole-4-carboxamide |
| SMILES | CC(=NNC(=O)c1c(CN2CCCC2)nnn1-c1nonc1N)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H18ClN9O2S/c1-9(11-4-5-12(17)29-11)19-21-16(27)13-10(8-25-6-2-3-7-25)20-24-26(13)15-14(18)22-28-23-15/h4-5H,2-3,6-8H2,1H3,(H2,18,22)(H,21,27) |
| InChIKey | YGSZMUDWJNVMSI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|