C20H20N10O5 — CID 5164349
3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(2,3-dioxoindol-1-yl)ethylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide (PubChem CID 5164349) has the molecular formula C20H20N10O5 and a molecular weight of 480.45 g/mol. Its IUPAC name is 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(2,3-dioxoindol-1-yl)ethylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide.
| Compound Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(2,3-dioxoindol-1-yl)ethylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 5164349 |
| Molecular Formula | C20H20N10O5 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 3-(4-amino-1,2,5-oxadiazol-3-yl)-N-[1-(2,3-dioxoindol-1-yl)ethylideneamino]-5-(morpholin-4-ylmethyl)triazole-4-carboxamide |
| SMILES | CC(=NNC(=O)c1c(CN2CCOCC2)nnn1-c1nonc1N)N1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C20H20N10O5/c1-11(29-14-5-3-2-4-12(14)16(31)20(29)33)22-24-19(32)15-13(10-28-6-8-34-9-7-28)23-27-30(15)18-17(21)25-35-26-18/h2-5H,6-10H2,1H3,(H2,21,25)(H,24,32) |
| InChIKey | UPEUTSUAIGXVRR-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 186.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|