C19H12N10O8 — CID 3843144
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide (PubChem CID 3843144) has the molecular formula C19H12N10O8 and a molecular weight of 508.37 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 3843144 |
| Molecular Formula | C19H12N10O8 |
| Molecular Weight | 508.37 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-5-(4-nitrophenyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)NN=Cc2cc3c(cc2[N+](=O)[O-])OCO3)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H12N10O8/c20-17-18(25-37-24-17)27-16(9-1-3-11(4-2-9)28(31)32)15(22-26-27)19(30)23-21-7-10-5-13-14(36-8-35-13)6-12(10)29(33)34/h1-7H,8H2,(H2,20,24)(H,23,30) |
| InChIKey | VKJUYPCBKZXWCR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 241.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|