C27H31N11O6 — CID 4579118
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methylideneamino]-5-[(4-methylpiperazin-1-yl)methyl]triazole-4-carboxamide (PubChem CID 4579118) has the molecular formula C27H31N11O6 and a molecular weight of 605.62 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methylideneamino]-5-[(4-methylpiperazin-1-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methylideneamino]-5-[(4-methylpiperazin-1-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 4579118 |
| Molecular Formula | C27H31N11O6 |
| Molecular Weight | 605.62 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[[4-methoxy-3-[(3-methyl-4-nitrophenoxy)methyl]phenyl]methylideneamino]-5-[(4-methylpiperazin-1-yl)methyl]triazole-4-carboxamide |
| SMILES | COc1ccc(C=NNC(=O)c2nnn(-c3nonc3N)c2CN2CCN(C)CC2)cc1COc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C27H31N11O6/c1-17-12-20(5-6-21(17)38(40)41)43-16-19-13-18(4-7-23(19)42-3)14-29-31-27(39)24-22(15-36-10-8-35(2)9-11-36)37(34-30-24)26-25(28)32-44-33-26/h4-7,12-14H,8-11,15-16H2,1-3H3,(H2,28,32)(H,31,39) |
| InChIKey | JQFSJMGWPSUCNF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 205.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.62 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|