C23H25N9O3 — CID 6179744
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-furan-2-ylmethylideneamino]triazole-4-carboxamide (PubChem CID 6179744) has the molecular formula C23H25N9O3 and a molecular weight of 475.51 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-furan-2-ylmethylideneamino]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-furan-2-ylmethylideneamino]triazole-4-carboxamide |
|---|---|
| PubChem CID | 6179744 |
| Molecular Formula | C23H25N9O3 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-[(4-benzylpiperidin-1-yl)methyl]-N-[(Z)-furan-2-ylmethylideneamino]triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)N/N=C\c2ccco2)c1CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N9O3/c24-21-22(29-35-28-21)32-19(20(26-30-32)23(33)27-25-14-18-7-4-12-34-18)15-31-10-8-17(9-11-31)13-16-5-2-1-3-6-16/h1-7,12,14,17H,8-11,13,15H2,(H2,24,28)(H,27,33)/b25-14- |
| InChIKey | UTKVSRPVUQUINN-QFEZKATASA-N |
| XLogP | 2.04 |
| TPSA | 153.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|