C20H27N10O4+ — CID 4685702
[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[[4-(diethylcarbamoyloxy)phenyl]methylideneamino]carbamoyl]triazol-4-yl]methyl-dimethylazanium (PubChem CID 4685702) has the molecular formula C20H27N10O4+ and a molecular weight of 471.50 g/mol. Its IUPAC name is [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[[4-(diethylcarbamoyloxy)phenyl]methylideneamino]carbamoyl]triazol-4-yl]methyl-dimethylazanium.
| Compound Name | [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[[4-(diethylcarbamoyloxy)phenyl]methylideneamino]carbamoyl]triazol-4-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 4685702 |
| Molecular Formula | C20H27N10O4+ |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[[4-(diethylcarbamoyloxy)phenyl]methylideneamino]carbamoyl]triazol-4-yl]methyl-dimethylazanium |
| SMILES | CCN(CC)C(=O)Oc1ccc(C=NNC(=O)c2nnn(-c3nonc3N)c2C[NH+](C)C)cc1 |
| InChI | InChI=1S/C20H26N10O4/c1-5-29(6-2)20(32)33-14-9-7-13(8-10-14)11-22-24-19(31)16-15(12-28(3)4)30(27-23-16)18-17(21)25-34-26-18/h7-11H,5-6,12H2,1-4H3,(H2,21,25)(H,24,31)/p+1 |
| InChIKey | QFYMGTLYMTUXML-UHFFFAOYSA-O |
| XLogP | -0.52 |
| TPSA | 171.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|