C17H20N9O2+ — CID 6295135
[3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(Z)-[(E)-3-phenylprop-2-enylidene]amino]carbamoyl]triazol-4-yl]methyl-dimethylazanium (PubChem CID 6295135) has the molecular formula C17H20N9O2+ and a molecular weight of 382.41 g/mol. Its IUPAC name is [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(Z)-[(E)-3-phenylprop-2-enylidene]amino]carbamoyl]triazol-4-yl]methyl-dimethylazanium.
| Compound Name | [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(Z)-[(E)-3-phenylprop-2-enylidene]amino]carbamoyl]triazol-4-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 6295135 |
| Molecular Formula | C17H20N9O2+ |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | [3-(4-amino-1,2,5-oxadiazol-3-yl)-5-[[(Z)-[(E)-3-phenylprop-2-enylidene]amino]carbamoyl]triazol-4-yl]methyl-dimethylazanium |
| SMILES | C[NH+](C)Cc1c(C(=O)N/N=C\C=C\c2ccccc2)nnn1-c1nonc1N |
| InChI | InChI=1S/C17H19N9O2/c1-25(2)11-13-14(20-24-26(13)16-15(18)22-28-23-16)17(27)21-19-10-6-9-12-7-4-3-5-8-12/h3-10H,11H2,1-2H3,(H2,18,22)(H,21,27)/p+1/b9-6+,19-10- |
| InChIKey | XAOTXJKNWFQEID-CAMSTOTOSA-O |
| XLogP | -0.69 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|