C21H26N9O2+ — CID 5176922
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(cinnamylideneamino)-5-[(4-methylpiperidin-1-ium-1-yl)methyl]triazole-4-carboxamide (PubChem CID 5176922) has the molecular formula C21H26N9O2+ and a molecular weight of 436.50 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(cinnamylideneamino)-5-[(4-methylpiperidin-1-ium-1-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(cinnamylideneamino)-5-[(4-methylpiperidin-1-ium-1-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 5176922 |
| Molecular Formula | C21H26N9O2+ |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-(cinnamylideneamino)-5-[(4-methylpiperidin-1-ium-1-yl)methyl]triazole-4-carboxamide |
| SMILES | CC1CC[NH+](Cc2c(C(=O)NN=CC=Cc3ccccc3)nnn2-c2nonc2N)CC1 |
| InChI | InChI=1S/C21H25N9O2/c1-15-9-12-29(13-10-15)14-17-18(24-28-30(17)20-19(22)26-32-27-20)21(31)25-23-11-5-8-16-6-3-2-4-7-16/h2-8,11,15H,9-10,12-14H2,1H3,(H2,22,26)(H,25,31)/p+1 |
| InChIKey | DWCIJNLXZGYNMB-UHFFFAOYSA-O |
| XLogP | 0.48 |
| TPSA | 141.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|