C17H18Cl2N9O3+ — CID 4155387
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dichlorophenyl)methylideneamino]-5-(morpholin-4-ium-4-ylmethyl)triazole-4-carboxamide (PubChem CID 4155387) has the molecular formula C17H18Cl2N9O3+ and a molecular weight of 467.30 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dichlorophenyl)methylideneamino]-5-(morpholin-4-ium-4-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dichlorophenyl)methylideneamino]-5-(morpholin-4-ium-4-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 4155387 |
| Molecular Formula | C17H18Cl2N9O3+ |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dichlorophenyl)methylideneamino]-5-(morpholin-4-ium-4-ylmethyl)triazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)NN=Cc2cccc(Cl)c2Cl)c1C[NH+]1CCOCC1 |
| InChI | InChI=1S/C17H17Cl2N9O3/c18-11-3-1-2-10(13(11)19)8-21-23-17(29)14-12(9-27-4-6-30-7-5-27)28(26-22-14)16-15(20)24-31-25-16/h1-3,8H,4-7,9H2,(H2,20,24)(H,23,29)/p+1 |
| InChIKey | VOJIRSXTDBJIRS-UHFFFAOYSA-O |
| XLogP | -0.28 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|