C16H13Cl2N11O2S — CID 4617602
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dichlorophenyl)methylideneamino]-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]triazole-4-carboxamide (PubChem CID 4617602) has the molecular formula C16H13Cl2N11O2S and a molecular weight of 494.33 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dichlorophenyl)methylideneamino]-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dichlorophenyl)methylideneamino]-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 4617602 |
| Molecular Formula | C16H13Cl2N11O2S |
| Molecular Weight | 494.33 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2,3-dichlorophenyl)methylideneamino]-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]triazole-4-carboxamide |
| SMILES | Cn1cnnc1SCc1c(C(=O)NN=Cc2cccc(Cl)c2Cl)nnn1-c1nonc1N |
| InChI | InChI=1S/C16H13Cl2N11O2S/c1-28-7-21-24-16(28)32-6-10-12(22-27-29(10)14-13(19)25-31-26-14)15(30)23-20-5-8-3-2-4-9(17)11(8)18/h2-5,7H,6H2,1H3,(H2,19,25)(H,23,30) |
| InChIKey | QYQTZPISXOHTFH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|