C17H16N10O3S — CID 171653844
N-[(E)-(2-hydroxyphenyl)methylideneamino]-1-(4-methyl-1,2,5-oxadiazol-3-yl)-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]triazole-4-carboxamide (PubChem CID 171653844) has the molecular formula C17H16N10O3S and a molecular weight of 440.45 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-1-(4-methyl-1,2,5-oxadiazol-3-yl)-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]triazole-4-carboxamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-1-(4-methyl-1,2,5-oxadiazol-3-yl)-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 171653844 |
| Molecular Formula | C17H16N10O3S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-1-(4-methyl-1,2,5-oxadiazol-3-yl)-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]triazole-4-carboxamide |
| SMILES | Cc1nonc1-n1nnc(C(=O)N/N=C/c2ccccc2O)c1CSc1nncn1C |
| InChI | InChI=1S/C17H16N10O3S/c1-10-15(24-30-23-10)27-12(8-31-17-22-19-9-26(17)2)14(20-25-27)16(29)21-18-7-11-5-3-4-6-13(11)28/h3-7,9,28H,8H2,1-2H3,(H,21,29)/b18-7+ |
| InChIKey | ITBJMAJHUOAEPF-CNHKJKLMSA-N |
| XLogP | 0.85 |
| TPSA | 162.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|