C22H17N13O6 — CID 6069013
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-[5-methyl-1-(4-nitrophenyl)triazol-4-yl]ethylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide (PubChem CID 6069013) has the molecular formula C22H17N13O6 and a molecular weight of 559.46 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-[5-methyl-1-(4-nitrophenyl)triazol-4-yl]ethylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-[5-methyl-1-(4-nitrophenyl)triazol-4-yl]ethylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 6069013 |
| Molecular Formula | C22H17N13O6 |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-1-[5-methyl-1-(4-nitrophenyl)triazol-4-yl]ethylideneamino]-5-(3-nitrophenyl)triazole-4-carboxamide |
| SMILES | C/C(=N/NC(=O)c1nnn(-c2nonc2N)c1-c1cccc([N+](=O)[O-])c1)c1nnn(-c2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C22H17N13O6/c1-11(17-12(2)32(30-25-17)14-6-8-15(9-7-14)34(37)38)24-27-22(36)18-19(13-4-3-5-16(10-13)35(39)40)33(31-26-18)21-20(23)28-41-29-21/h3-10H,1-2H3,(H2,23,28)(H,27,36)/b24-11- |
| InChIKey | YRZYSFWNROQLFB-MYKKPKGFSA-N |
| XLogP | 1.76 |
| TPSA | 254.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|