C18H14ClN7O5 — CID 92844445
2-chloro-N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]-4-nitrobenzamide (PubChem CID 92844445) has the molecular formula C18H14ClN7O5 and a molecular weight of 443.81 g/mol. Its IUPAC name is 2-chloro-N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 92844445 |
| Molecular Formula | C18H14ClN7O5 |
| Molecular Weight | 443.81 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2-chloro-N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]-4-nitrobenzamide |
| SMILES | C/C(=N\NC(=O)c1ccc([N+](=O)[O-])cc1Cl)c1nnn(-c2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C18H14ClN7O5/c1-10(20-22-18(27)15-7-6-14(26(30)31)9-16(15)19)17-11(2)24(23-21-17)12-4-3-5-13(8-12)25(28)29/h3-9H,1-2H3,(H,22,27)/b20-10+ |
| InChIKey | QBKGAODQYKBDKF-KEBDBYFISA-N |
| XLogP | 3.20 |
| TPSA | 158.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|