C18H15N7O5 — CID 92844358
N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]-3-nitrobenzamide (PubChem CID 92844358) has the molecular formula C18H15N7O5 and a molecular weight of 409.36 g/mol. Its IUPAC name is N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 92844358 |
| Molecular Formula | C18H15N7O5 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]-3-nitrobenzamide |
| SMILES | C/C(=N\NC(=O)c1cccc([N+](=O)[O-])c1)c1nnn(-c2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C18H15N7O5/c1-11(19-21-18(26)13-5-3-7-15(9-13)24(27)28)17-12(2)23(22-20-17)14-6-4-8-16(10-14)25(29)30/h3-10H,1-2H3,(H,21,26)/b19-11+ |
| InChIKey | ZZNWIEPURVZDIC-YBFXNURJSA-N |
| XLogP | 2.55 |
| TPSA | 158.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|