C14H13N7O3 — CID 92844081
2-cyano-N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]acetamide (PubChem CID 92844081) has the molecular formula C14H13N7O3 and a molecular weight of 327.30 g/mol. Its IUPAC name is 2-cyano-N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]acetamide.
| Compound Name | 2-cyano-N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]acetamide |
|---|---|
| PubChem CID | 92844081 |
| Molecular Formula | C14H13N7O3 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-cyano-N-[(E)-1-[5-methyl-1-(3-nitrophenyl)triazol-4-yl]ethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)CC#N)c1nnn(-c2cccc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C14H13N7O3/c1-9(16-17-13(22)6-7-15)14-10(2)20(19-18-14)11-4-3-5-12(8-11)21(23)24/h3-5,8H,6H2,1-2H3,(H,17,22)/b16-9+ |
| InChIKey | AADQHFXXJUNUQL-CXUHLZMHSA-N |
| XLogP | 1.24 |
| TPSA | 139.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|