C24H15N9O4 — CID 3348108
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-nitrofluoren-9-ylidene)amino]-5-phenyltriazole-4-carboxamide (PubChem CID 3348108) has the molecular formula C24H15N9O4 and a molecular weight of 493.44 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-nitrofluoren-9-ylidene)amino]-5-phenyltriazole-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-nitrofluoren-9-ylidene)amino]-5-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 3348108 |
| Molecular Formula | C24H15N9O4 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(2-nitrofluoren-9-ylidene)amino]-5-phenyltriazole-4-carboxamide |
| SMILES | Nc1nonc1-n1nnc(C(=O)NN=C2c3ccccc3-c3ccc([N+](=O)[O-])cc32)c1-c1ccccc1 |
| InChI | InChI=1S/C24H15N9O4/c25-22-23(30-37-29-22)32-21(13-6-2-1-3-7-13)20(27-31-32)24(34)28-26-19-17-9-5-4-8-15(17)16-11-10-14(33(35)36)12-18(16)19/h1-12H,(H2,25,29)(H,28,34) |
| InChIKey | CVFNBNIVTFEJAI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 180.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|