C16H16N11O3S+ — CID 171653827
1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-hydroxyphenyl)methylideneamino]-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2H-triazol-1-ium-4-carboxamide (PubChem CID 171653827) has the molecular formula C16H16N11O3S+ and a molecular weight of 442.45 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-hydroxyphenyl)methylideneamino]-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2H-triazol-1-ium-4-carboxamide.
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-hydroxyphenyl)methylideneamino]-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2H-triazol-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 171653827 |
| Molecular Formula | C16H16N11O3S+ |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(E)-(3-hydroxyphenyl)methylideneamino]-5-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2H-triazol-1-ium-4-carboxamide |
| SMILES | Cn1cnnc1SCc1c(C(=O)N/N=C/c2cccc(O)c2)n[nH][n+]1-c1nonc1N |
| InChI | InChI=1S/C16H15N11O3S/c1-26-8-19-22-16(26)31-7-11-12(20-25-27(11)14-13(17)23-30-24-14)15(29)21-18-6-9-3-2-4-10(28)5-9/h2-6,8H,7H2,1H3,(H4,17,21,23,28,29)/p+1/b18-6+ |
| InChIKey | XROHBANSULKIRI-NGYBGAFCSA-O |
| XLogP | -0.46 |
| TPSA | 189.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|