C21H18N8O6 — CID 135484308
2-[4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-methoxyphenyl)-2H-triazol-1-ium-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 135484308) has the molecular formula C21H18N8O6 and a molecular weight of 478.43 g/mol. Its IUPAC name is 2-[4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-methoxyphenyl)-2H-triazol-1-ium-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-methoxyphenyl)-2H-triazol-1-ium-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 135484308 |
| Molecular Formula | C21H18N8O6 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-[4-[(E)-[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(3-methoxyphenyl)-2H-triazol-1-ium-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COc1cccc(-c2c(C(=O)N/N=C/c3ccc(OCC(=O)[O-])cc3)n[nH][n+]2-c2nonc2N)c1 |
| InChI | InChI=1S/C21H18N8O6/c1-33-15-4-2-3-13(9-15)18-17(24-28-29(18)20-19(22)26-35-27-20)21(32)25-23-10-12-5-7-14(8-6-12)34-11-16(30)31/h2-10H,11H2,1H3,(H4,22,25,26,30,31,32)/b23-10+ |
| InChIKey | UWIREGPYOMFURP-AUEPDCJTSA-N |
| XLogP | -0.78 |
| TPSA | 197.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|