C21H17N8O7+ — CID 135399496
2-[4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-2H-triazol-1-ium-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 135399496) has the molecular formula C21H17N8O7+ and a molecular weight of 493.42 g/mol. Its IUPAC name is 2-[4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-2H-triazol-1-ium-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-2H-triazol-1-ium-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 135399496 |
| Molecular Formula | C21H17N8O7+ |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 2-[4-[[[1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(1,3-benzodioxol-5-yl)-2H-triazol-1-ium-4-carbonyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | Nc1nonc1-[n+]1[nH]nc(C(=O)NN=Cc2ccc(OCC(=O)O)cc2)c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H16N8O7/c22-19-20(27-36-26-19)29-18(12-3-6-14-15(7-12)35-10-34-14)17(24-28-29)21(32)25-23-8-11-1-4-13(5-2-11)33-9-16(30)31/h1-8H,9-10H2,(H4,22,25,26,30,31,32)/p+1 |
| InChIKey | QBHUNGQFECXVHO-UHFFFAOYSA-O |
| XLogP | 0.27 |
| TPSA | 203.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|