C19H17Cl3N4O5 — CID 126016119
N-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide (PubChem CID 126016119) has the molecular formula C19H17Cl3N4O5 and a molecular weight of 487.73 g/mol. Its IUPAC name is N-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 126016119 |
| Molecular Formula | C19H17Cl3N4O5 |
| Molecular Weight | 487.73 g/mol |
| Exact Mass | 486.03 |
| IUPAC Name | N-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)cc(Cl)c1Cl)N/N=C\c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H17Cl3N4O5/c20-13-8-14(21)19(22)17(9-13)31-11-18(27)24-23-10-12-1-2-15(16(7-12)26(28)29)25-3-5-30-6-4-25/h1-2,7-10H,3-6,11H2,(H,24,27)/b23-10- |
| InChIKey | ASTRLXXMZMIERM-RMORIDSASA-N |
| XLogP | 3.92 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|