C28H20N4O5 — CID 126054425
N-[(Z)-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126054425) has the molecular formula C28H20N4O5 and a molecular weight of 492.49 g/mol. Its IUPAC name is N-[(Z)-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126054425 |
| Molecular Formula | C28H20N4O5 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | N-[(Z)-[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | COc1ccc(-c2ccc(/C=N\NC(=O)c3cc(-c4ccccc4)nc4ccccc34)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H20N4O5/c1-36-19-11-13-22(26(15-19)32(34)35)27-14-12-20(37-27)17-29-31-28(33)23-16-25(18-7-3-2-4-8-18)30-24-10-6-5-9-21(23)24/h2-17H,1H3,(H,31,33)/b29-17- |
| InChIKey | VPMFSWZGPPBAIE-RHANQZHGSA-N |
| XLogP | 5.84 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|