C27H17Cl2N3O2 — CID 126042034
N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126042034) has the molecular formula C27H17Cl2N3O2 and a molecular weight of 486.36 g/mol. Its IUPAC name is N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126042034 |
| Molecular Formula | C27H17Cl2N3O2 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.07 |
| IUPAC Name | N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(-c2cc(Cl)ccc2Cl)o1)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C27H17Cl2N3O2/c28-18-10-12-23(29)22(14-18)26-13-11-19(34-26)16-30-32-27(33)21-15-25(17-6-2-1-3-7-17)31-24-9-5-4-8-20(21)24/h1-16H,(H,32,33)/b30-16+ |
| InChIKey | JNZDVUVJABRIPB-OKCVXOCRSA-N |
| XLogP | 7.23 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|