C31H26ClN3O2 — CID 6007197
2-(4-tert-butylphenyl)-N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]quinoline-4-carboxamide (PubChem CID 6007197) has the molecular formula C31H26ClN3O2 and a molecular weight of 508.02 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6007197 |
| Molecular Formula | C31H26ClN3O2 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[(Z)-[5-(3-chlorophenyl)furan-2-yl]methylideneamino]quinoline-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2cc(C(=O)N/N=C\c3ccc(-c4cccc(Cl)c4)o3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C31H26ClN3O2/c1-31(2,3)22-13-11-20(12-14-22)28-18-26(25-9-4-5-10-27(25)34-28)30(36)35-33-19-24-15-16-29(37-24)21-7-6-8-23(32)17-21/h4-19H,1-3H3,(H,35,36)/b33-19- |
| InChIKey | IFRSAQJDFJLTSJ-APTWKGOFSA-N |
| XLogP | 7.88 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|