C24H21N3O2 — CID 1226428
2-(3,4-dimethylphenyl)-N-[(5-methylfuran-2-yl)methylideneamino]quinoline-4-carboxamide (PubChem CID 1226428) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-[(5-methylfuran-2-yl)methylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)-N-[(5-methylfuran-2-yl)methylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 1226428 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-[(5-methylfuran-2-yl)methylideneamino]quinoline-4-carboxamide |
| SMILES | Cc1ccc(C=NNC(=O)c2cc(-c3ccc(C)c(C)c3)nc3ccccc23)o1 |
| InChI | InChI=1S/C24H21N3O2/c1-15-8-10-18(12-16(15)2)23-13-21(20-6-4-5-7-22(20)26-23)24(28)27-25-14-19-11-9-17(3)29-19/h4-14H,1-3H3,(H,27,28) |
| InChIKey | NHLLCEXMYDWSQQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|