C28H20ClN3O2 — CID 126045050
N-[(Z)-[5-(5-chloro-2-methylphenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide (PubChem CID 126045050) has the molecular formula C28H20ClN3O2 and a molecular weight of 465.94 g/mol. Its IUPAC name is N-[(Z)-[5-(5-chloro-2-methylphenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[(Z)-[5-(5-chloro-2-methylphenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 126045050 |
| Molecular Formula | C28H20ClN3O2 |
| Molecular Weight | 465.94 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | N-[(Z)-[5-(5-chloro-2-methylphenyl)furan-2-yl]methylideneamino]-2-phenylquinoline-4-carboxamide |
| SMILES | Cc1ccc(Cl)cc1-c1ccc(/C=N\NC(=O)c2cc(-c3ccccc3)nc3ccccc23)o1 |
| InChI | InChI=1S/C28H20ClN3O2/c1-18-11-12-20(29)15-23(18)27-14-13-21(34-27)17-30-32-28(33)24-16-26(19-7-3-2-4-8-19)31-25-10-6-5-9-22(24)25/h2-17H,1H3,(H,32,33)/b30-17- |
| InChIKey | PQOBYHPQMUKOJU-LQNQUEJISA-N |
| XLogP | 6.89 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.94 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|