C22H24Br2N2O3 — CID 136695749
trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(Z)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 136695749) has the molecular formula C22H24Br2N2O3 and a molecular weight of 524.25 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(Z)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(Z)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 136695749 |
| Molecular Formula | C22H24Br2N2O3 |
| Molecular Weight | 524.25 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(Z)-(2,3-dibromo-6-hydroxy-5-methoxyphenyl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | COc1cc(Br)c(Br)c(/C=N\NC(=O)[C@H]2C[C@@H]2c2ccc(C(C)(C)C)cc2)c1O |
| InChI | InChI=1S/C22H24Br2N2O3/c1-22(2,3)13-7-5-12(6-8-13)14-9-15(14)21(28)26-25-11-16-19(24)17(23)10-18(29-4)20(16)27/h5-8,10-11,14-15,27H,9H2,1-4H3,(H,26,28)/b25-11-/t14-,15+/m1/s1 |
| InChIKey | VJRVVJJYNOQHPV-WRDQCUHZSA-N |
| XLogP | 5.48 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.25 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|