C23H27IN2O3 — CID 6307555
2-(4-tert-butylphenyl)-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 6307555) has the molecular formula C23H27IN2O3 and a molecular weight of 506.38 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6307555 |
| Molecular Formula | C23H27IN2O3 |
| Molecular Weight | 506.38 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[(Z)-(3-iodo-4,5-dimethoxyphenyl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)C2CC2c2ccc(C(C)(C)C)cc2)cc(I)c1OC |
| InChI | InChI=1S/C23H27IN2O3/c1-23(2,3)16-8-6-15(7-9-16)17-12-18(17)22(27)26-25-13-14-10-19(24)21(29-5)20(11-14)28-4/h6-11,13,17-18H,12H2,1-5H3,(H,26,27)/b25-13- |
| InChIKey | CXDDXIKKMMOBLW-MXAYSNPKSA-N |
| XLogP | 4.86 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|