C24H30N2O3 — CID 6968783
trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(3-ethoxy-4-methoxyphenyl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 6968783) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(3-ethoxy-4-methoxyphenyl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(3-ethoxy-4-methoxyphenyl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 6968783 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | trans-(1S,2S)-2-(4-tert-butylphenyl)-N-[(3-ethoxy-4-methoxyphenyl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | CCOc1cc(C=NNC(=O)[C@H]2C[C@@H]2c2ccc(C(C)(C)C)cc2)ccc1OC |
| InChI | InChI=1S/C24H30N2O3/c1-6-29-22-13-16(7-12-21(22)28-5)15-25-26-23(27)20-14-19(20)17-8-10-18(11-9-17)24(2,3)4/h7-13,15,19-20H,6,14H2,1-5H3,(H,26,27)/t19-,20+/m1/s1 |
| InChIKey | UROKZENYCBJYBM-UXHICEINSA-N |
| XLogP | 4.65 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|