C29H30Cl2N2O3 — CID 39815068
cis-(1R,2S)-2-(4-tert-butylphenyl)-N-[(E)-[3-[(2,3-dichlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]cyclopropane-1-carboxamide (PubChem CID 39815068) has the molecular formula C29H30Cl2N2O3 and a molecular weight of 525.48 g/mol. Its IUPAC name is cis-(1R,2S)-2-(4-tert-butylphenyl)-N-[(E)-[3-[(2,3-dichlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-(4-tert-butylphenyl)-N-[(E)-[3-[(2,3-dichlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 39815068 |
| Molecular Formula | C29H30Cl2N2O3 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | cis-(1R,2S)-2-(4-tert-butylphenyl)-N-[(E)-[3-[(2,3-dichlorophenoxy)methyl]-4-methoxyphenyl]methylideneamino]cyclopropane-1-carboxamide |
| SMILES | COc1ccc(/C=N/NC(=O)[C@@H]2C[C@@H]2c2ccc(C(C)(C)C)cc2)cc1COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C29H30Cl2N2O3/c1-29(2,3)21-11-9-19(10-12-21)22-15-23(22)28(34)33-32-16-18-8-13-25(35-4)20(14-18)17-36-26-7-5-6-24(30)27(26)31/h5-14,16,22-23H,15,17H2,1-4H3,(H,33,34)/b32-16+/t22-,23-/m1/s1 |
| InChIKey | ZOCYOQCMSSJFGU-NAGGEUOPSA-N |
| XLogP | 7.13 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|