C26H17Cl2N3O3 — CID 46495734
N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 46495734) has the molecular formula C26H17Cl2N3O3 and a molecular weight of 490.35 g/mol. Its IUPAC name is N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 46495734 |
| Molecular Formula | C26H17Cl2N3O3 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | N-[(E)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)N/N=C/c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C26H17Cl2N3O3/c27-16-9-11-21(28)20(13-16)24-12-10-17(34-24)14-29-30-25(32)15-31-22-7-3-1-5-18(22)26(33)19-6-2-4-8-23(19)31/h1-14H,15H2,(H,30,32)/b29-14+ |
| InChIKey | OXCQOBWTGJKBQK-IPPBACCNSA-N |
| XLogP | 5.87 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|