C18H18FN5O4 — CID 5222623
N'-[[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-N-(4-fluorophenyl)propanediamide (PubChem CID 5222623) has the molecular formula C18H18FN5O4 and a molecular weight of 387.37 g/mol. Its IUPAC name is N'-[[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-N-(4-fluorophenyl)propanediamide.
| Compound Name | N'-[[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-N-(4-fluorophenyl)propanediamide |
|---|---|
| PubChem CID | 5222623 |
| Molecular Formula | C18H18FN5O4 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N'-[[4-(dimethylamino)-3-nitrophenyl]methylideneamino]-N-(4-fluorophenyl)propanediamide |
| SMILES | CN(C)c1ccc(C=NNC(=O)CC(=O)Nc2ccc(F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18FN5O4/c1-23(2)15-8-3-12(9-16(15)24(27)28)11-20-22-18(26)10-17(25)21-14-6-4-13(19)5-7-14/h3-9,11H,10H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | OOGQKJCPMDWOTI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|