C17H16FN3O2S — CID 4218868
N-(4-fluorophenyl)-N'-[(4-methylsulfanylphenyl)methylideneamino]propanediamide (PubChem CID 4218868) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N'-[(4-methylsulfanylphenyl)methylideneamino]propanediamide.
| Compound Name | N-(4-fluorophenyl)-N'-[(4-methylsulfanylphenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 4218868 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-(4-fluorophenyl)-N'-[(4-methylsulfanylphenyl)methylideneamino]propanediamide |
| SMILES | CSc1ccc(C=NNC(=O)CC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H16FN3O2S/c1-24-15-8-2-12(3-9-15)11-19-21-17(23)10-16(22)20-14-6-4-13(18)5-7-14/h2-9,11H,10H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | HRITVCUGXYFEMP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|