C21H24N4O5 — CID 7550433
(2S)-N-benzyl-2-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]oxypropanamide (PubChem CID 7550433) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]oxypropanamide.
| Compound Name | (2S)-N-benzyl-2-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]oxypropanamide |
|---|---|
| PubChem CID | 7550433 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (2S)-N-benzyl-2-[(Z)-(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]oxypropanamide |
| SMILES | C[C@H](O/N=C\c1ccc(N2CCOCC2)c([N+](=O)[O-])c1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C21H24N4O5/c1-16(21(26)22-14-17-5-3-2-4-6-17)30-23-15-18-7-8-19(20(13-18)25(27)28)24-9-11-29-12-10-24/h2-8,13,15-16H,9-12,14H2,1H3,(H,22,26)/b23-15-/t16-/m0/s1 |
| InChIKey | QFLYJEWNBFCSCS-VBHMAFOESA-N |
| XLogP | 2.49 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|