C13H17F2N3O5S — CID 133467929
N-[1-[2-(difluoromethoxy)-4-nitrophenyl]piperidin-4-yl]methanesulfonamide (PubChem CID 133467929) has the molecular formula C13H17F2N3O5S and a molecular weight of 365.36 g/mol. Its IUPAC name is N-[1-[2-(difluoromethoxy)-4-nitrophenyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[2-(difluoromethoxy)-4-nitrophenyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 133467929 |
| Molecular Formula | C13H17F2N3O5S |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-[1-[2-(difluoromethoxy)-4-nitrophenyl]piperidin-4-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC1CCN(c2ccc([N+](=O)[O-])cc2OC(F)F)CC1 |
| InChI | InChI=1S/C13H17F2N3O5S/c1-24(21,22)16-9-4-6-17(7-5-9)11-3-2-10(18(19)20)8-12(11)23-13(14)15/h2-3,8-9,13,16H,4-7H2,1H3 |
| InChIKey | BCKZMXCUMDJCRW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|