C15H19F2N3O4 — CID 133498676
4-[2-(difluoromethoxy)-4-nitrophenyl]-1-(2-methylpropyl)piperazin-2-one (PubChem CID 133498676) has the molecular formula C15H19F2N3O4 and a molecular weight of 343.33 g/mol. Its IUPAC name is 4-[2-(difluoromethoxy)-4-nitrophenyl]-1-(2-methylpropyl)piperazin-2-one.
| Compound Name | 4-[2-(difluoromethoxy)-4-nitrophenyl]-1-(2-methylpropyl)piperazin-2-one |
|---|---|
| PubChem CID | 133498676 |
| Molecular Formula | C15H19F2N3O4 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-[2-(difluoromethoxy)-4-nitrophenyl]-1-(2-methylpropyl)piperazin-2-one |
| SMILES | CC(C)CN1CCN(c2ccc([N+](=O)[O-])cc2OC(F)F)CC1=O |
| InChI | InChI=1S/C15H19F2N3O4/c1-10(2)8-19-6-5-18(9-14(19)21)12-4-3-11(20(22)23)7-13(12)24-15(16)17/h3-4,7,10,15H,5-6,8-9H2,1-2H3 |
| InChIKey | CASCDZWEFXQQFI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|