C23H26F4N6O8 — CID 87679317
1-[2-(difluoromethoxy)-4-nitrophenyl]piperazine;4-[2-(difluoromethoxy)-4-nitrophenyl]piperazine-1-carboxylic acid (PubChem CID 87679317) has the molecular formula C23H26F4N6O8 and a molecular weight of 590.49 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-4-nitrophenyl]piperazine;4-[2-(difluoromethoxy)-4-nitrophenyl]piperazine-1-carboxylic acid.
| Compound Name | 1-[2-(difluoromethoxy)-4-nitrophenyl]piperazine;4-[2-(difluoromethoxy)-4-nitrophenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87679317 |
| Molecular Formula | C23H26F4N6O8 |
| Molecular Weight | 590.49 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | 1-[2-(difluoromethoxy)-4-nitrophenyl]piperazine;4-[2-(difluoromethoxy)-4-nitrophenyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2ccc([N+](=O)[O-])cc2OC(F)F)CC1.O=[N+]([O-])c1ccc(N2CCNCC2)c(OC(F)F)c1 |
| InChI | InChI=1S/C12H13F2N3O5.C11H13F2N3O3/c13-11(14)22-10-7-8(17(20)21)1-2-9(10)15-3-5-16(6-4-15)12(18)19;12-11(13)19-10-7-8(16(17)18)1-2-9(10)15-5-3-14-4-6-15/h1-2,7,11H,3-6H2,(H,18,19);1-2,7,11,14H,3-6H2 |
| InChIKey | CEEBTUBNXVOWEZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|