C15H17N3O5 — CID 21232194
1-[(2,6-dimethylmorpholin-4-yl)methyl]-5-nitroindole-2,3-dione (PubChem CID 21232194) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-[(2,6-dimethylmorpholin-4-yl)methyl]-5-nitroindole-2,3-dione.
| Compound Name | 1-[(2,6-dimethylmorpholin-4-yl)methyl]-5-nitroindole-2,3-dione |
|---|---|
| PubChem CID | 21232194 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-[(2,6-dimethylmorpholin-4-yl)methyl]-5-nitroindole-2,3-dione |
| SMILES | CC1CN(CN2C(=O)C(=O)c3cc([N+](=O)[O-])ccc32)CC(C)O1 |
| InChI | InChI=1S/C15H17N3O5/c1-9-6-16(7-10(2)23-9)8-17-13-4-3-11(18(21)22)5-12(13)14(19)15(17)20/h3-5,9-10H,6-8H2,1-2H3 |
| InChIKey | BVKDPYJADIRMSE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|