C20H26N6O3S — CID 133334775
[5-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]-2-nitrophenyl]-pyrrolidin-1-ylmethanone (PubChem CID 133334775) has the molecular formula C20H26N6O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is [5-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]-2-nitrophenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]-2-nitrophenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 133334775 |
| Molecular Formula | C20H26N6O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | [5-[4-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,4-diazepan-1-yl]-2-nitrophenyl]-pyrrolidin-1-ylmethanone |
| SMILES | CCc1nsc(N2CCCN(c3ccc([N+](=O)[O-])c(C(=O)N4CCCC4)c3)CC2)n1 |
| InChI | InChI=1S/C20H26N6O3S/c1-2-18-21-20(30-22-18)25-11-5-10-23(12-13-25)15-6-7-17(26(28)29)16(14-15)19(27)24-8-3-4-9-24/h6-7,14H,2-5,8-13H2,1H3 |
| InChIKey | QMHOXVNAMAJVKK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 95.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|