C17H15Cl2N3O5S — CID 27757654
[4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-(2-nitrophenyl)methanone (PubChem CID 27757654) has the molecular formula C17H15Cl2N3O5S and a molecular weight of 444.30 g/mol. Its IUPAC name is [4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-(2-nitrophenyl)methanone.
| Compound Name | [4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 27757654 |
| Molecular Formula | C17H15Cl2N3O5S |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | [4-(2,6-dichlorophenyl)sulfonylpiperazin-1-yl]-(2-nitrophenyl)methanone |
| SMILES | O=C(c1ccccc1[N+](=O)[O-])N1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C17H15Cl2N3O5S/c18-13-5-3-6-14(19)16(13)28(26,27)21-10-8-20(9-11-21)17(23)12-4-1-2-7-15(12)22(24)25/h1-7H,8-11H2 |
| InChIKey | PRGHTUMEVQGSFZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|