C19H19ClN2O4S — CID 19132675
6-[4-(4-chlorophenyl)piperazin-1-yl]sulfonyl-3,4-dihydrochromen-2-one (PubChem CID 19132675) has the molecular formula C19H19ClN2O4S and a molecular weight of 406.89 g/mol. Its IUPAC name is 6-[4-(4-chlorophenyl)piperazin-1-yl]sulfonyl-3,4-dihydrochromen-2-one.
| Compound Name | 6-[4-(4-chlorophenyl)piperazin-1-yl]sulfonyl-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 19132675 |
| Molecular Formula | C19H19ClN2O4S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 6-[4-(4-chlorophenyl)piperazin-1-yl]sulfonyl-3,4-dihydrochromen-2-one |
| SMILES | O=C1CCc2cc(S(=O)(=O)N3CCN(c4ccc(Cl)cc4)CC3)ccc2O1 |
| InChI | InChI=1S/C19H19ClN2O4S/c20-15-2-4-16(5-3-15)21-9-11-22(12-10-21)27(24,25)17-6-7-18-14(13-17)1-8-19(23)26-18/h2-7,13H,1,8-12H2 |
| InChIKey | BRGJLEBHQLGDOV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|