C25H22Cl2F3N3O3S — CID 169172477
4-(chloromethyl)-N-[4-[4-[3-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]benzamide (PubChem CID 169172477) has the molecular formula C25H22Cl2F3N3O3S and a molecular weight of 572.44 g/mol. Its IUPAC name is 4-(chloromethyl)-N-[4-[4-[3-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]benzamide.
| Compound Name | 4-(chloromethyl)-N-[4-[4-[3-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 169172477 |
| Molecular Formula | C25H22Cl2F3N3O3S |
| Molecular Weight | 572.44 g/mol |
| Exact Mass | 571.07 |
| IUPAC Name | 4-(chloromethyl)-N-[4-[4-[3-chloro-5-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylphenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCN(c3cc(Cl)cc(C(F)(F)F)c3)CC2)cc1)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C25H22Cl2F3N3O3S/c26-16-17-1-3-18(4-2-17)24(34)31-21-5-7-23(8-6-21)37(35,36)33-11-9-32(10-12-33)22-14-19(25(28,29)30)13-20(27)15-22/h1-8,13-15H,9-12,16H2,(H,31,34) |
| InChIKey | DDCJRQGBWBMNTH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|