C24H23ClF3N5O4S — CID 169172410
5-(aminomethyl)-N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-2-hydroxybenzamide (PubChem CID 169172410) has the molecular formula C24H23ClF3N5O4S and a molecular weight of 569.99 g/mol. Its IUPAC name is 5-(aminomethyl)-N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-2-hydroxybenzamide.
| Compound Name | 5-(aminomethyl)-N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 169172410 |
| Molecular Formula | C24H23ClF3N5O4S |
| Molecular Weight | 569.99 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | 5-(aminomethyl)-N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-2-hydroxybenzamide |
| SMILES | NCc1ccc(O)c(C(=O)Nc2ccc(S(=O)(=O)N3CCN(c4cc(C(F)(F)F)cc(Cl)n4)CC3)cc2)c1 |
| InChI | InChI=1S/C24H23ClF3N5O4S/c25-21-12-16(24(26,27)28)13-22(31-21)32-7-9-33(10-8-32)38(36,37)18-4-2-17(3-5-18)30-23(35)19-11-15(14-29)1-6-20(19)34/h1-6,11-13,34H,7-10,14,29H2,(H,30,35) |
| InChIKey | FDEKMMCHFMGLQQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.99 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|