C22H26ClF3N6O3S — CID 169172377
N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-2-piperazin-1-ylacetamide (PubChem CID 169172377) has the molecular formula C22H26ClF3N6O3S and a molecular weight of 547.00 g/mol. Its IUPAC name is N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-2-piperazin-1-ylacetamide.
| Compound Name | N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 169172377 |
| Molecular Formula | C22H26ClF3N6O3S |
| Molecular Weight | 547.00 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | N-[4-[4-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonylphenyl]-2-piperazin-1-ylacetamide |
| SMILES | O=C(CN1CCNCC1)Nc1ccc(S(=O)(=O)N2CCN(c3cc(C(F)(F)F)cc(Cl)n3)CC2)cc1 |
| InChI | InChI=1S/C22H26ClF3N6O3S/c23-19-13-16(22(24,25)26)14-20(29-19)31-9-11-32(12-10-31)36(34,35)18-3-1-17(2-4-18)28-21(33)15-30-7-5-27-6-8-30/h1-4,13-14,27H,5-12,15H2,(H,28,33) |
| InChIKey | FCHWHRHBJYGKEM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.00 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|